C17H16FNO4S — CID 2555289
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-(4-fluorophenyl)-4-oxobutanoate (PubChem CID 2555289) has the molecular formula C17H16FNO4S and a molecular weight of 349.38 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-(4-fluorophenyl)-4-oxobutanoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-(4-fluorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 2555289 |
| Molecular Formula | C17H16FNO4S |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-(4-fluorophenyl)-4-oxobutanoate |
| SMILES | O=C(COC(=O)CCC(=O)c1ccc(F)cc1)NCc1cccs1 |
| InChI | InChI=1S/C17H16FNO4S/c18-13-5-3-12(4-6-13)15(20)7-8-17(22)23-11-16(21)19-10-14-2-1-9-24-14/h1-6,9H,7-8,10-11H2,(H,19,21) |
| InChIKey | LYGSURHDTGPULW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |