C20H26N2O4 — CID 55449115
[2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 2-(2-bicyclo[2.2.1]heptanyl)acetate (PubChem CID 55449115) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 2-(2-bicyclo[2.2.1]heptanyl)acetate.
| Compound Name | [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 2-(2-bicyclo[2.2.1]heptanyl)acetate |
|---|---|
| PubChem CID | 55449115 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 2-(2-bicyclo[2.2.1]heptanyl)acetate |
| SMILES | NC(=O)CCN(C(=O)COC(=O)CC1CC2CCC1C2)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O4/c21-18(23)8-9-22(17-4-2-1-3-5-17)19(24)13-26-20(25)12-16-11-14-6-7-15(16)10-14/h1-5,14-16H,6-13H2,(H2,21,23) |
| InChIKey | ZIHOEFSVGXCQRP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |