C17H15Cl2N3O4 — CID 27592198
[2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 27592198) has the molecular formula C17H15Cl2N3O4 and a molecular weight of 396.23 g/mol. Its IUPAC name is [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 27592198 |
| Molecular Formula | C17H15Cl2N3O4 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | NC(=O)CCN(C(=O)COC(=O)c1nc(Cl)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C17H15Cl2N3O4/c18-12-6-7-13(19)21-16(12)17(25)26-10-15(24)22(9-8-14(20)23)11-4-2-1-3-5-11/h1-7H,8-10H2,(H2,20,23) |
| InChIKey | YAEFKLCCMVZUAP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|