C18H14Cl3N3O3 — CID 46665883
[2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 46665883) has the molecular formula C18H14Cl3N3O3 and a molecular weight of 426.69 g/mol. Its IUPAC name is [2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 46665883 |
| Molecular Formula | C18H14Cl3N3O3 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | [2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | Cc1cc(N(CCC#N)C(=O)COC(=O)c2nc(Cl)ccc2Cl)ccc1Cl |
| InChI | InChI=1S/C18H14Cl3N3O3/c1-11-9-12(3-4-13(11)19)24(8-2-7-22)16(25)10-27-18(26)17-14(20)5-6-15(21)23-17/h3-6,9H,2,8,10H2,1H3 |
| InChIKey | UZNGSYPQIBPCEQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|