C19H15Cl2N3O5 — CID 41202509
[2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] 4-chloro-3-nitrobenzoate (PubChem CID 41202509) has the molecular formula C19H15Cl2N3O5 and a molecular weight of 436.25 g/mol. Its IUPAC name is [2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] 4-chloro-3-nitrobenzoate.
| Compound Name | [2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 41202509 |
| Molecular Formula | C19H15Cl2N3O5 |
| Molecular Weight | 436.25 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | [2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] 4-chloro-3-nitrobenzoate |
| SMILES | Cc1cc(N(CCC#N)C(=O)COC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)ccc1Cl |
| InChI | InChI=1S/C19H15Cl2N3O5/c1-12-9-14(4-6-15(12)20)23(8-2-7-22)18(25)11-29-19(26)13-3-5-16(21)17(10-13)24(27)28/h3-6,9-10H,2,8,11H2,1H3 |
| InChIKey | SNZCCEJEQVYPKG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 113.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.25 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|