C20H17ClN6O3 — CID 55467507
[2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] 2-(tetrazol-1-yl)benzoate (PubChem CID 55467507) has the molecular formula C20H17ClN6O3 and a molecular weight of 424.85 g/mol. Its IUPAC name is [2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] 2-(tetrazol-1-yl)benzoate.
| Compound Name | [2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] 2-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 55467507 |
| Molecular Formula | C20H17ClN6O3 |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | [2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] 2-(tetrazol-1-yl)benzoate |
| SMILES | Cc1cc(N(CCC#N)C(=O)COC(=O)c2ccccc2-n2cnnn2)ccc1Cl |
| InChI | InChI=1S/C20H17ClN6O3/c1-14-11-15(7-8-17(14)21)26(10-4-9-22)19(28)12-30-20(29)16-5-2-3-6-18(16)27-13-23-24-25-27/h2-3,5-8,11,13H,4,10,12H2,1H3 |
| InChIKey | VYCPKKSDFBWDKK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 114.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |