C24H20ClN3O3 — CID 24571166
[2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate (PubChem CID 24571166) has the molecular formula C24H20ClN3O3 and a molecular weight of 433.90 g/mol. Its IUPAC name is [2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate.
| Compound Name | [2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 24571166 |
| Molecular Formula | C24H20ClN3O3 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | [2-[4-chloro-N-(2-cyanoethyl)-3-methylanilino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate |
| SMILES | Cc1cc(N(CCC#N)C(=O)COC(=O)/C=C/c2ccc3ccccc3n2)ccc1Cl |
| InChI | InChI=1S/C24H20ClN3O3/c1-17-15-20(10-11-21(17)25)28(14-4-13-26)23(29)16-31-24(30)12-9-19-8-7-18-5-2-3-6-22(18)27-19/h2-3,5-12,15H,4,14,16H2,1H3/b12-9+ |
| InChIKey | LYZPPZOTVHKEPQ-FMIVXFBMSA-N |
| XLogP | 4.70 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|