C19H24N4O5 — CID 9011441
[2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl] 3-nitro-4-piperidin-1-ylbenzoate (PubChem CID 9011441) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is [2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl] 3-nitro-4-piperidin-1-ylbenzoate.
| Compound Name | [2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl] 3-nitro-4-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 9011441 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl] 3-nitro-4-piperidin-1-ylbenzoate |
| SMILES | CN(C(=O)COC(=O)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1)C(C)(C)C#N |
| InChI | InChI=1S/C19H24N4O5/c1-19(2,13-20)21(3)17(24)12-28-18(25)14-7-8-15(16(11-14)23(26)27)22-9-5-4-6-10-22/h7-8,11H,4-6,9-10,12H2,1-3H3 |
| InChIKey | CFPZMOGUQWMQDE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 116.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|