C28H25N3O5 — CID 4551307
[2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate (PubChem CID 4551307) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is [2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate.
| Compound Name | [2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 4551307 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | [2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
| SMILES | Cn1c(-c2ccccc2)c(C(=O)COC(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)c2ccccc21 |
| InChI | InChI=1S/C28H25N3O5/c1-29-22-12-6-5-11-21(22)26(27(29)19-9-3-2-4-10-19)25(32)18-36-28(33)20-13-14-23(24(17-20)31(34)35)30-15-7-8-16-30/h2-6,9-14,17H,7-8,15-16,18H2,1H3 |
| InChIKey | SFIQUTZETRCDRV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 94.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|