About [2-(3-nitrophenyl)-2-oxoethyl] 3-formamidobenzoate
[2-(3-nitrophenyl)-2-oxoethyl] 3-formamidobenzoate (PubChem CID 168652711) has the molecular formula C16H12N2O6
and a molecular weight of 328.28 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 3-formamidobenzoate.
Molecular Properties
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 3-formamidobenzoate |
| PubChem CID | 168652711 |
| Molecular Formula | C16H12N2O6 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 3-formamidobenzoate |
| SMILES | O=CNc1cccc(C(=O)OCC(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C16H12N2O6/c19-10-17-13-5-1-4-12(7-13)16(21)24-9-15(20)11-3-2-6-14(8-11)18(22)23/h1-8,10H,9H2,(H,17,19) |
| InChIKey | RBTCXCFMYVIDCV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(3-nitrophenyl)-2-oxoethyl] 3-formamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-nitrophenyl)-2-oxoethyl] 3-formamidobenzoate?
The IUPAC name of [2-(3-nitrophenyl)-2-oxoethyl] 3-formamidobenzoate (CID 168652711) is [2-(3-nitrophenyl)-2-oxoethyl] 3-formamidobenzoate.
What is the SMILES notation for [2-(3-nitrophenyl)-2-oxoethyl] 3-formamidobenzoate?
The canonical SMILES for [2-(3-nitrophenyl)-2-oxoethyl] 3-formamidobenzoate is O=CNc1cccc(C(=O)OCC(=O)c2cccc([N+](=O)[O-])c2)c1.
What is the InChIKey of [2-(3-nitrophenyl)-2-oxoethyl] 3-formamidobenzoate?
The InChIKey is RBTCXCFMYVIDCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O6/c19-10-17-13-5-1-4-12(7-13)16(21)24-9-15(20)11-3-2-6-14(8-11)18(22)23/h1-8,10H,9H2,(H,17,19).
What are the key properties of [2-(3-nitrophenyl)-2-oxoethyl] 3-formamidobenzoate?
[2-(3-nitrophenyl)-2-oxoethyl] 3-formamidobenzoate has a molecular weight of 328.28 g/mol, XLogP of 2.20, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-nitrophenyl)-2-oxoethyl] 3-formamidobenzoate is sourced from PubChem (CID 168652711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).