C22H16FN3O2 — CID 167789716
1-(3-cyanophenyl)-N-[5-(4-fluorophenoxy)-2-pyridinyl]cyclopropane-1-carboxamide (PubChem CID 167789716) has the molecular formula C22H16FN3O2 and a molecular weight of 373.39 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-N-[5-(4-fluorophenoxy)-2-pyridinyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(3-cyanophenyl)-N-[5-(4-fluorophenoxy)-2-pyridinyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 167789716 |
| Molecular Formula | C22H16FN3O2 |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-(3-cyanophenyl)-N-[5-(4-fluorophenoxy)-2-pyridinyl]cyclopropane-1-carboxamide |
| SMILES | N#Cc1cccc(C2(C(=O)Nc3ccc(Oc4ccc(F)cc4)cn3)CC2)c1 |
| InChI | InChI=1S/C22H16FN3O2/c23-17-4-6-18(7-5-17)28-19-8-9-20(25-14-19)26-21(27)22(10-11-22)16-3-1-2-15(12-16)13-24/h1-9,12,14H,10-11H2,(H,25,26,27) |
| InChIKey | ANYWUJBBEGBGIQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |