C21H29N3O5 — CID 8949977
[2-(butylcarbamoylamino)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate (PubChem CID 8949977) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is [2-(butylcarbamoylamino)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate.
| Compound Name | [2-(butylcarbamoylamino)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 8949977 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | [2-(butylcarbamoylamino)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate |
| SMILES | CCCCNC(=O)NC(=O)COC(=O)C1(c2ccccc2)CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C21H29N3O5/c1-3-4-12-22-20(28)23-18(26)15-29-19(27)21(17-8-6-5-7-9-17)10-13-24(14-11-21)16(2)25/h5-9H,3-4,10-15H2,1-2H3,(H2,22,23,26,28) |
| InChIKey | KUOLQRLZAHKFJD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|