C17H23NO3 — CID 3968744
[2-oxo-2-(1-phenylethylamino)ethyl] 2-cyclopentylacetate (PubChem CID 3968744) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is [2-oxo-2-(1-phenylethylamino)ethyl] 2-cyclopentylacetate.
| Compound Name | [2-oxo-2-(1-phenylethylamino)ethyl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 3968744 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [2-oxo-2-(1-phenylethylamino)ethyl] 2-cyclopentylacetate |
| SMILES | CC(NC(=O)COC(=O)CC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C17H23NO3/c1-13(15-9-3-2-4-10-15)18-16(19)12-21-17(20)11-14-7-5-6-8-14/h2-4,9-10,13-14H,5-8,11-12H2,1H3,(H,18,19) |
| InChIKey | IJSUZLFFQQLPBG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |