C21H24N2O5 — CID 21175645
[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] 2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate (PubChem CID 21175645) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] 2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate.
| Compound Name | [2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] 2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate |
|---|---|
| PubChem CID | 21175645 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | [2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] 2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate |
| SMILES | C[C@@H](NC(=O)COC(=O)CN1C(=O)[C@@H]2[C@H]3CC[C@@H](C3)[C@@H]2C1=O)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O5/c1-12(13-5-3-2-4-6-13)22-16(24)11-28-17(25)10-23-20(26)18-14-7-8-15(9-14)19(18)21(23)27/h2-6,12,14-15,18-19H,7-11H2,1H3,(H,22,24)/t12-,14+,15+,18-,19+/m1/s1 |
| InChIKey | AXYGARITSDDBDW-ZBERQUOHSA-N |
| XLogP | 1.44 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|