C17H21F2NO4 — CID 35776405
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-cyclohexylacetate (PubChem CID 35776405) has the molecular formula C17H21F2NO4 and a molecular weight of 341.35 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-cyclohexylacetate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-cyclohexylacetate |
|---|---|
| PubChem CID | 35776405 |
| Molecular Formula | C17H21F2NO4 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-cyclohexylacetate |
| SMILES | O=C(COC(=O)CC1CCCCC1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H21F2NO4/c18-17(19)24-14-8-6-13(7-9-14)20-15(21)11-23-16(22)10-12-4-2-1-3-5-12/h6-9,12,17H,1-5,10-11H2,(H,20,21) |
| InChIKey | ZTZXGBRBVZNORO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |