C12H14Cl2N4O2 — CID 62491302
N-(4-amino-2,6-dichlorophenyl)-2-(3-methyl-2-oxoimidazolidin-1-yl)acetamide (PubChem CID 62491302) has the molecular formula C12H14Cl2N4O2 and a molecular weight of 317.18 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-(3-methyl-2-oxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-(3-methyl-2-oxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 62491302 |
| Molecular Formula | C12H14Cl2N4O2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-(3-methyl-2-oxoimidazolidin-1-yl)acetamide |
| SMILES | CN1CCN(CC(=O)Nc2c(Cl)cc(N)cc2Cl)C1=O |
| InChI | InChI=1S/C12H14Cl2N4O2/c1-17-2-3-18(12(17)20)6-10(19)16-11-8(13)4-7(15)5-9(11)14/h4-5H,2-3,6,15H2,1H3,(H,16,19) |
| InChIKey | PIIZDVULEGQXOY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|