C23H25N3O5 — CID 84558804
2-(1,3-dioxoisoindol-2-yl)-N-[4-(1-hydroxy-3-morpholin-4-ylpropyl)phenyl]acetamide (PubChem CID 84558804) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[4-(1-hydroxy-3-morpholin-4-ylpropyl)phenyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[4-(1-hydroxy-3-morpholin-4-ylpropyl)phenyl]acetamide |
|---|---|
| PubChem CID | 84558804 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[4-(1-hydroxy-3-morpholin-4-ylpropyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1ccc(C(O)CCN2CCOCC2)cc1 |
| InChI | InChI=1S/C23H25N3O5/c27-20(9-10-25-11-13-31-14-12-25)16-5-7-17(8-6-16)24-21(28)15-26-22(29)18-3-1-2-4-19(18)23(26)30/h1-8,20,27H,9-15H2,(H,24,28) |
| InChIKey | RQXZUAFIDTWKOS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|