C19H18IN3O3 — CID 108889428
1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(4-iodo-2-methylphenyl)urea (PubChem CID 108889428) has the molecular formula C19H18IN3O3 and a molecular weight of 463.28 g/mol. Its IUPAC name is 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(4-iodo-2-methylphenyl)urea.
| Compound Name | 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(4-iodo-2-methylphenyl)urea |
|---|---|
| PubChem CID | 108889428 |
| Molecular Formula | C19H18IN3O3 |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(4-iodo-2-methylphenyl)urea |
| SMILES | Cc1cc(I)ccc1NC(=O)NCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H18IN3O3/c1-12-11-13(20)7-8-16(12)22-19(26)21-9-4-10-23-17(24)14-5-2-3-6-15(14)18(23)25/h2-3,5-8,11H,4,9-10H2,1H3,(H2,21,22,26) |
| InChIKey | XKBCBZAMSJOWON-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|