C22H18Cl2N2O5S — CID 2127348
2-(3-acetylphenoxy)-N-[2-[(5Z)-5-[(3,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide (PubChem CID 2127348) has the molecular formula C22H18Cl2N2O5S and a molecular weight of 493.37 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-N-[2-[(5Z)-5-[(3,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide.
| Compound Name | 2-(3-acetylphenoxy)-N-[2-[(5Z)-5-[(3,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 2127348 |
| Molecular Formula | C22H18Cl2N2O5S |
| Molecular Weight | 493.37 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | 2-(3-acetylphenoxy)-N-[2-[(5Z)-5-[(3,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
| SMILES | CC(=O)c1cccc(OCC(=O)NCCN2C(=O)S/C(=C\c3ccc(Cl)c(Cl)c3)C2=O)c1 |
| InChI | InChI=1S/C22H18Cl2N2O5S/c1-13(27)15-3-2-4-16(11-15)31-12-20(28)25-7-8-26-21(29)19(32-22(26)30)10-14-5-6-17(23)18(24)9-14/h2-6,9-11H,7-8,12H2,1H3,(H,25,28)/b19-10- |
| InChIKey | LDIBEWQEQVZDEC-GRSHGNNSSA-N |
| XLogP | 4.43 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|