C24H18N4O6S — CID 38355384
N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide (PubChem CID 38355384) has the molecular formula C24H18N4O6S and a molecular weight of 490.50 g/mol. Its IUPAC name is N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide.
| Compound Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide |
|---|---|
| PubChem CID | 38355384 |
| Molecular Formula | C24H18N4O6S |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide |
| SMILES | Cc1oc(-n2cccc2)c(C#N)c1C(=O)NCCN1C(=O)S/C(=C\c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C24H18N4O6S/c1-14-20(16(12-25)23(34-14)27-7-2-3-8-27)21(29)26-6-9-28-22(30)19(35-24(28)31)11-15-4-5-17-18(10-15)33-13-32-17/h2-5,7-8,10-11H,6,9,13H2,1H3,(H,26,29)/b19-11- |
| InChIKey | INSLRQKQTYHYGG-ODLFYWEKSA-N |
| XLogP | 3.45 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|