C19H13BrN2O5S — CID 126357923
2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-bromophenyl)acetamide (PubChem CID 126357923) has the molecular formula C19H13BrN2O5S and a molecular weight of 461.29 g/mol. Its IUPAC name is 2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-bromophenyl)acetamide.
| Compound Name | 2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-bromophenyl)acetamide |
|---|---|
| PubChem CID | 126357923 |
| Molecular Formula | C19H13BrN2O5S |
| Molecular Weight | 461.29 g/mol |
| Exact Mass | 459.97 |
| IUPAC Name | 2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-bromophenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc3c(c2)OCO3)C1=O)Nc1ccccc1Br |
| InChI | InChI=1S/C19H13BrN2O5S/c20-12-3-1-2-4-13(12)21-17(23)9-22-18(24)16(28-19(22)25)8-11-5-6-14-15(7-11)27-10-26-14/h1-8H,9-10H2,(H,21,23)/b16-8+ |
| InChIKey | WZFVRQDYQXQLEL-LZYBPNLTSA-N |
| XLogP | 3.85 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|