C17H16N2O6S2 — CID 94545324
2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[(3R,4S)-4-hydroxythiolan-3-yl]acetamide (PubChem CID 94545324) has the molecular formula C17H16N2O6S2 and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[(3R,4S)-4-hydroxythiolan-3-yl]acetamide.
| Compound Name | 2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[(3R,4S)-4-hydroxythiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 94545324 |
| Molecular Formula | C17H16N2O6S2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[(3R,4S)-4-hydroxythiolan-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc3c(c2)OCO3)C1=O)N[C@H]1CSC[C@H]1O |
| InChI | InChI=1S/C17H16N2O6S2/c20-11-7-26-6-10(11)18-15(21)5-19-16(22)14(27-17(19)23)4-9-1-2-12-13(3-9)25-8-24-12/h1-4,10-11,20H,5-8H2,(H,18,21)/b14-4-/t10-,11+/m0/s1 |
| InChIKey | MCPVEVPOSPYBGD-VEYMCRPASA-N |
| XLogP | 1.04 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|