C14H14N2O5S2 — CID 45369573
2-[(5Z)-5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-hydroxythiolan-3-yl)acetamide (PubChem CID 45369573) has the molecular formula C14H14N2O5S2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-[(5Z)-5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-hydroxythiolan-3-yl)acetamide.
| Compound Name | 2-[(5Z)-5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-hydroxythiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 45369573 |
| Molecular Formula | C14H14N2O5S2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 2-[(5Z)-5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-hydroxythiolan-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccco2)C1=O)NC1CSCC1O |
| InChI | InChI=1S/C14H14N2O5S2/c17-10-7-22-6-9(10)15-12(18)5-16-13(19)11(23-14(16)20)4-8-2-1-3-21-8/h1-4,9-10,17H,5-7H2,(H,15,18)/b11-4- |
| InChIKey | GSEILHXZBLZUPS-WCIBSUBMSA-N |
| XLogP | 0.91 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|