C17H17ClN2O4S2 — CID 94545338
3-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[(3S,4S)-4-hydroxythiolan-3-yl]propanamide (PubChem CID 94545338) has the molecular formula C17H17ClN2O4S2 and a molecular weight of 412.92 g/mol. Its IUPAC name is 3-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[(3S,4S)-4-hydroxythiolan-3-yl]propanamide.
| Compound Name | 3-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[(3S,4S)-4-hydroxythiolan-3-yl]propanamide |
|---|---|
| PubChem CID | 94545338 |
| Molecular Formula | C17H17ClN2O4S2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 3-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[(3S,4S)-4-hydroxythiolan-3-yl]propanamide |
| SMILES | O=C(CCN1C(=O)S/C(=C\c2ccc(Cl)cc2)C1=O)N[C@@H]1CSC[C@H]1O |
| InChI | InChI=1S/C17H17ClN2O4S2/c18-11-3-1-10(2-4-11)7-14-16(23)20(17(24)26-14)6-5-15(22)19-12-8-25-9-13(12)21/h1-4,7,12-13,21H,5-6,8-9H2,(H,19,22)/b14-7-/t12-,13-/m1/s1 |
| InChIKey | QPOKCRFDNCYMOW-HBMOZRESSA-N |
| XLogP | 2.36 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|