C18H21ClN3O3S+ — CID 3274580
5-[(4-chlorophenyl)methylidene]-3-[3-(4-methylpiperazin-4-ium-1-yl)-3-oxopropyl]-1,3-thiazolidine-2,4-dione (PubChem CID 3274580) has the molecular formula C18H21ClN3O3S+ and a molecular weight of 394.90 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methylidene]-3-[3-(4-methylpiperazin-4-ium-1-yl)-3-oxopropyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(4-chlorophenyl)methylidene]-3-[3-(4-methylpiperazin-4-ium-1-yl)-3-oxopropyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3274580 |
| Molecular Formula | C18H21ClN3O3S+ |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 5-[(4-chlorophenyl)methylidene]-3-[3-(4-methylpiperazin-4-ium-1-yl)-3-oxopropyl]-1,3-thiazolidine-2,4-dione |
| SMILES | C[NH+]1CCN(C(=O)CCN2C(=O)SC(=Cc3ccc(Cl)cc3)C2=O)CC1 |
| InChI | InChI=1S/C18H20ClN3O3S/c1-20-8-10-21(11-9-20)16(23)6-7-22-17(24)15(26-18(22)25)12-13-2-4-14(19)5-3-13/h2-5,12H,6-11H2,1H3/p+1 |
| InChIKey | LTSQSTMEVNPZQL-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|