C17H17ClN2O3S3 — CID 94545387
3-[(5Z)-5-[(3-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(3S,4R)-4-hydroxythiolan-3-yl]propanamide (PubChem CID 94545387) has the molecular formula C17H17ClN2O3S3 and a molecular weight of 428.99 g/mol. Its IUPAC name is 3-[(5Z)-5-[(3-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(3S,4R)-4-hydroxythiolan-3-yl]propanamide.
| Compound Name | 3-[(5Z)-5-[(3-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(3S,4R)-4-hydroxythiolan-3-yl]propanamide |
|---|---|
| PubChem CID | 94545387 |
| Molecular Formula | C17H17ClN2O3S3 |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | 3-[(5Z)-5-[(3-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(3S,4R)-4-hydroxythiolan-3-yl]propanamide |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cccc(Cl)c2)SC1=S)N[C@@H]1CSC[C@@H]1O |
| InChI | InChI=1S/C17H17ClN2O3S3/c18-11-3-1-2-10(6-11)7-14-16(23)20(17(24)26-14)5-4-15(22)19-12-8-25-9-13(12)21/h1-3,6-7,12-13,21H,4-5,8-9H2,(H,19,22)/b14-7-/t12-,13+/m1/s1 |
| InChIKey | LPTHVJWTDZMISO-PTRWATSXSA-N |
| XLogP | 2.52 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|