C17H15ClN2O4S3 — CID 51664264
3-[(5E)-5-[(3-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]propanamide (PubChem CID 51664264) has the molecular formula C17H15ClN2O4S3 and a molecular weight of 442.97 g/mol. Its IUPAC name is 3-[(5E)-5-[(3-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]propanamide.
| Compound Name | 3-[(5E)-5-[(3-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]propanamide |
|---|---|
| PubChem CID | 51664264 |
| Molecular Formula | C17H15ClN2O4S3 |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | 3-[(5E)-5-[(3-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]propanamide |
| SMILES | O=C(CCN1C(=O)/C(=C\c2cccc(Cl)c2)SC1=S)N[C@@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C17H15ClN2O4S3/c18-12-3-1-2-11(8-12)9-14-16(22)20(17(25)26-14)6-4-15(21)19-13-5-7-27(23,24)10-13/h1-3,5,7-9,13H,4,6,10H2,(H,19,21)/b14-9+/t13-/m1/s1 |
| InChIKey | ZJVANMDHZJMKDZ-OZYJXZHSSA-N |
| XLogP | 2.36 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|