C15H14N2O5S3 — CID 6225276
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide (PubChem CID 6225276) has the molecular formula C15H14N2O5S3 and a molecular weight of 398.49 g/mol. Its IUPAC name is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 6225276 |
| Molecular Formula | C15H14N2O5S3 |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide |
| SMILES | O=C(CCN1C(=O)S/C(=C\c2cccs2)C1=O)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C15H14N2O5S3/c18-13(16-10-4-7-25(21,22)9-10)3-5-17-14(19)12(24-15(17)20)8-11-2-1-6-23-11/h1-2,4,6-8,10H,3,5,9H2,(H,16,18)/b12-8- |
| InChIKey | VWRSUQVLEUJCPG-WQLSENKSSA-N |
| XLogP | 1.60 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|