C18H15ClN2O5S2 — CID 4899190
2-[5-(2-chloro-3-phenylprop-2-enylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetamide (PubChem CID 4899190) has the molecular formula C18H15ClN2O5S2 and a molecular weight of 438.91 g/mol. Its IUPAC name is 2-[5-(2-chloro-3-phenylprop-2-enylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetamide.
| Compound Name | 2-[5-(2-chloro-3-phenylprop-2-enylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetamide |
|---|---|
| PubChem CID | 4899190 |
| Molecular Formula | C18H15ClN2O5S2 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | 2-[5-(2-chloro-3-phenylprop-2-enylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)SC(=CC(Cl)=Cc2ccccc2)C1=O)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C18H15ClN2O5S2/c19-13(8-12-4-2-1-3-5-12)9-15-17(23)21(18(24)27-15)10-16(22)20-14-6-7-28(25,26)11-14/h1-9,14H,10-11H2,(H,20,22) |
| InChIKey | QJCCVJVIDGPUKV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|