C15H14N2O4S4 — CID 6226060
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide (PubChem CID 6226060) has the molecular formula C15H14N2O4S4 and a molecular weight of 414.56 g/mol. Its IUPAC name is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 6226060 |
| Molecular Formula | C15H14N2O4S4 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide |
| SMILES | CC(C(=O)NC1C=CS(=O)(=O)C1)N1C(=O)/C(=C\c2cccs2)SC1=S |
| InChI | InChI=1S/C15H14N2O4S4/c1-9(13(18)16-10-4-6-25(20,21)8-10)17-14(19)12(24-15(17)22)7-11-3-2-5-23-11/h2-7,9-10H,8H2,1H3,(H,16,18)/b12-7+ |
| InChIKey | CHJGTWWHJNTCPL-KPKJPENVSA-N |
| XLogP | 1.76 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|