C18H18N2O5S2 — CID 4893306
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-4-[(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]benzamide (PubChem CID 4893306) has the molecular formula C18H18N2O5S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-4-[(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]benzamide.
| Compound Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-4-[(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]benzamide |
|---|---|
| PubChem CID | 4893306 |
| Molecular Formula | C18H18N2O5S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-4-[(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]benzamide |
| SMILES | CC(C)N1C(=O)SC(=Cc2ccc(C(=O)NC3C=CS(=O)(=O)C3)cc2)C1=O |
| InChI | InChI=1S/C18H18N2O5S2/c1-11(2)20-17(22)15(26-18(20)23)9-12-3-5-13(6-4-12)16(21)19-14-7-8-27(24,25)10-14/h3-9,11,14H,10H2,1-2H3,(H,19,21) |
| InChIKey | MAYGCXHBRHTUMJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|