C15H15NO4S — CID 6342625
4-[(E)-[3-[(2R)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid (PubChem CID 6342625) has the molecular formula C15H15NO4S and a molecular weight of 305.36 g/mol. Its IUPAC name is 4-[(E)-[3-[(2R)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid.
| Compound Name | 4-[(E)-[3-[(2R)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 6342625 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 4-[(E)-[3-[(2R)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
| SMILES | CC[C@@H](C)N1C(=O)S/C(=C/c2ccc(C(=O)O)cc2)C1=O |
| InChI | InChI=1S/C15H15NO4S/c1-3-9(2)16-13(17)12(21-15(16)20)8-10-4-6-11(7-5-10)14(18)19/h4-9H,3H2,1-2H3,(H,18,19)/b12-8+/t9-/m1/s1 |
| InChIKey | CDEHCKCDXDGRSX-YXYQAXARSA-N |
| XLogP | 3.22 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|