C14H12ClNO4S — CID 6294715
3-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 6294715) has the molecular formula C14H12ClNO4S and a molecular weight of 325.77 g/mol. Its IUPAC name is 3-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 3-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 6294715 |
| Molecular Formula | C14H12ClNO4S |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 3-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | CC(CC(=O)O)N1C(=O)S/C(=C\c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C14H12ClNO4S/c1-8(6-12(17)18)16-13(19)11(21-14(16)20)7-9-2-4-10(15)5-3-9/h2-5,7-8H,6H2,1H3,(H,17,18)/b11-7- |
| InChIKey | PKWYDQXTZRVTFM-XFFZJAGNSA-N |
| XLogP | 3.24 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|