C19H21ClN2O4S2 — CID 16631761
6-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]hexanoic acid (PubChem CID 16631761) has the molecular formula C19H21ClN2O4S2 and a molecular weight of 440.97 g/mol. Its IUPAC name is 6-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]hexanoic acid.
| Compound Name | 6-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 16631761 |
| Molecular Formula | C19H21ClN2O4S2 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 6-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]hexanoic acid |
| SMILES | CC(C(=O)NCCCCCC(=O)O)N1C(=O)/C(=C/c2ccc(Cl)cc2)SC1=S |
| InChI | InChI=1S/C19H21ClN2O4S2/c1-12(17(25)21-10-4-2-3-5-16(23)24)22-18(26)15(28-19(22)27)11-13-6-8-14(20)9-7-13/h6-9,11-12H,2-5,10H2,1H3,(H,21,25)(H,23,24)/b15-11- |
| InChIKey | PAVBJPOYWBKSPP-PTNGSMBKSA-N |
| XLogP | 3.69 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|