C16H15FN2O4S2 — CID 16631731
3-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]propanoic acid (PubChem CID 16631731) has the molecular formula C16H15FN2O4S2 and a molecular weight of 382.44 g/mol. Its IUPAC name is 3-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]propanoic acid.
| Compound Name | 3-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 16631731 |
| Molecular Formula | C16H15FN2O4S2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 3-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]propanoic acid |
| SMILES | CC(C(=O)NCCC(=O)O)N1C(=O)/C(=C/c2ccc(F)cc2)SC1=S |
| InChI | InChI=1S/C16H15FN2O4S2/c1-9(14(22)18-7-6-13(20)21)19-15(23)12(25-16(19)24)8-10-2-4-11(17)5-3-10/h2-5,8-9H,6-7H2,1H3,(H,18,22)(H,20,21)/b12-8- |
| InChIKey | GMXDVXCZBMKNDJ-WQLSENKSSA-N |
| XLogP | 2.01 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|