C18H20N2O5S2 — CID 16631789
4-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]butanoic acid (PubChem CID 16631789) has the molecular formula C18H20N2O5S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]butanoic acid.
| Compound Name | 4-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 16631789 |
| Molecular Formula | C18H20N2O5S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 4-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]butanoic acid |
| SMILES | COc1ccc(/C=C2\SC(=S)N(C(C)C(=O)NCCCC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C18H20N2O5S2/c1-11(16(23)19-9-3-4-15(21)22)20-17(24)14(27-18(20)26)10-12-5-7-13(25-2)8-6-12/h5-8,10-11H,3-4,9H2,1-2H3,(H,19,23)(H,21,22)/b14-10- |
| InChIKey | AVIKYLDWBSWPKC-UVTDQMKNSA-N |
| XLogP | 2.27 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|