C21H26N2O4S — CID 4900204
5-[[4-[2-(2-hydroxyethyl)piperidine-1-carbonyl]phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione (PubChem CID 4900204) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is 5-[[4-[2-(2-hydroxyethyl)piperidine-1-carbonyl]phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(2-hydroxyethyl)piperidine-1-carbonyl]phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4900204 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 5-[[4-[2-(2-hydroxyethyl)piperidine-1-carbonyl]phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)N1C(=O)SC(=Cc2ccc(C(=O)N3CCCCC3CCO)cc2)C1=O |
| InChI | InChI=1S/C21H26N2O4S/c1-14(2)23-20(26)18(28-21(23)27)13-15-6-8-16(9-7-15)19(25)22-11-4-3-5-17(22)10-12-24/h6-9,13-14,17,24H,3-5,10-12H2,1-2H3 |
| InChIKey | XEUGRNLYBHUVON-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|