C14H11N3O2S4 — CID 16631856
2-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 16631856) has the molecular formula C14H11N3O2S4 and a molecular weight of 381.53 g/mol. Its IUPAC name is 2-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 2-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 16631856 |
| Molecular Formula | C14H11N3O2S4 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 2-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | CC(C(=O)Nc1nccs1)N1C(=O)/C(=C/c2cccs2)SC1=S |
| InChI | InChI=1S/C14H11N3O2S4/c1-8(11(18)16-13-15-4-6-22-13)17-12(19)10(23-14(17)20)7-9-3-2-5-21-9/h2-8H,1H3,(H,15,16,18)/b10-7- |
| InChIKey | WTRMLEHHCJMDIU-YFHOEESVSA-N |
| XLogP | 3.43 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|