C16H13N3O4S3 — CID 16631874
2-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 16631874) has the molecular formula C16H13N3O4S3 and a molecular weight of 407.50 g/mol. Its IUPAC name is 2-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 2-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 16631874 |
| Molecular Formula | C16H13N3O4S3 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 2-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | CC(C(=O)Nc1nccs1)N1C(=O)/C(=C/c2ccc(O)cc2O)SC1=S |
| InChI | InChI=1S/C16H13N3O4S3/c1-8(13(22)18-15-17-4-5-25-15)19-14(23)12(26-16(19)24)6-9-2-3-10(20)7-11(9)21/h2-8,20-21H,1H3,(H,17,18,22)/b12-6- |
| InChIKey | QJABJGOHLJRPLQ-SDQBBNPISA-N |
| XLogP | 2.78 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|