C19H15ClN2O4S2 — CID 16631409
N-(4-chlorophenyl)-2-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide (PubChem CID 16631409) has the molecular formula C19H15ClN2O4S2 and a molecular weight of 434.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-(4-chlorophenyl)-2-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 16631409 |
| Molecular Formula | C19H15ClN2O4S2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(Cl)cc1)N1C(=O)/C(=C/c2ccc(O)cc2O)SC1=S |
| InChI | InChI=1S/C19H15ClN2O4S2/c1-10(17(25)21-13-5-3-12(20)4-6-13)22-18(26)16(28-19(22)27)8-11-2-7-14(23)9-15(11)24/h2-10,23-24H,1H3,(H,21,25)/b16-8- |
| InChIKey | IUKMWAKNFPSUPE-PXNMLYILSA-N |
| XLogP | 3.98 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|