C20H16N2O5S2 — CID 4912656
2-[2-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)propanoylamino]-5-hydroxybenzoic acid (PubChem CID 4912656) has the molecular formula C20H16N2O5S2 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-[2-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)propanoylamino]-5-hydroxybenzoic acid.
| Compound Name | 2-[2-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)propanoylamino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 4912656 |
| Molecular Formula | C20H16N2O5S2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 2-[2-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)propanoylamino]-5-hydroxybenzoic acid |
| SMILES | CC(C(=O)Nc1ccc(O)cc1C(=O)O)N1C(=O)C(=Cc2ccccc2)SC1=S |
| InChI | InChI=1S/C20H16N2O5S2/c1-11(17(24)21-15-8-7-13(23)10-14(15)19(26)27)22-18(25)16(29-20(22)28)9-12-5-3-2-4-6-12/h2-11,23H,1H3,(H,21,24)(H,26,27) |
| InChIKey | HXYLFWKNQZKYSC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|