C20H15F3N2O3S2 — CID 16631472
2-[(5Z)-5-[(3-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 16631472) has the molecular formula C20H15F3N2O3S2 and a molecular weight of 452.48 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[(5Z)-5-[(3-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 16631472 |
| Molecular Formula | C20H15F3N2O3S2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 2-[(5Z)-5-[(3-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1ccccc1C(F)(F)F)N1C(=O)/C(=C/c2cccc(O)c2)SC1=S |
| InChI | InChI=1S/C20H15F3N2O3S2/c1-11(17(27)24-15-8-3-2-7-14(15)20(21,22)23)25-18(28)16(30-19(25)29)10-12-5-4-6-13(26)9-12/h2-11,26H,1H3,(H,24,27)/b16-10- |
| InChIKey | WSIKDZBACWQTNF-YBEGLDIGSA-N |
| XLogP | 4.64 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|