C24H23F3N2O2S2 — CID 16631450
2-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 16631450) has the molecular formula C24H23F3N2O2S2 and a molecular weight of 492.59 g/mol. Its IUPAC name is 2-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 16631450 |
| Molecular Formula | C24H23F3N2O2S2 |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 2-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1ccccc1C(F)(F)F)N1C(=O)/C(=C/c2ccc(C(C)(C)C)cc2)SC1=S |
| InChI | InChI=1S/C24H23F3N2O2S2/c1-14(20(30)28-18-8-6-5-7-17(18)24(25,26)27)29-21(31)19(33-22(29)32)13-15-9-11-16(12-10-15)23(2,3)4/h5-14H,1-4H3,(H,28,30)/b19-13- |
| InChIKey | RCXZTPZRLGZKPX-UYRXBGFRSA-N |
| XLogP | 6.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|