C26H22N2O2S2 — CID 16631307
N-(2-methylphenyl)-2-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide (PubChem CID 16631307) has the molecular formula C26H22N2O2S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-(2-methylphenyl)-2-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 16631307 |
| Molecular Formula | C26H22N2O2S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | N-(2-methylphenyl)-2-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
| SMILES | Cc1ccccc1NC(=O)C(C)N1C(=O)/C(=C/c2ccc(-c3ccccc3)cc2)SC1=S |
| InChI | InChI=1S/C26H22N2O2S2/c1-17-8-6-7-11-22(17)27-24(29)18(2)28-25(30)23(32-26(28)31)16-19-12-14-21(15-13-19)20-9-4-3-5-10-20/h3-16,18H,1-2H3,(H,27,29)/b23-16- |
| InChIKey | UKKRUDYOELMOGN-KQWNVCNZSA-N |
| XLogP | 5.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|