C20H13Cl2F3N2O2S2 — CID 16631458
2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 16631458) has the molecular formula C20H13Cl2F3N2O2S2 and a molecular weight of 505.37 g/mol. Its IUPAC name is 2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 16631458 |
| Molecular Formula | C20H13Cl2F3N2O2S2 |
| Molecular Weight | 505.37 g/mol |
| Exact Mass | 503.97 |
| IUPAC Name | 2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1ccccc1C(F)(F)F)N1C(=O)/C(=C/c2cccc(Cl)c2Cl)SC1=S |
| InChI | InChI=1S/C20H13Cl2F3N2O2S2/c1-10(17(28)26-14-8-3-2-6-12(14)20(23,24)25)27-18(29)15(31-19(27)30)9-11-5-4-7-13(21)16(11)22/h2-10H,1H3,(H,26,28)/b15-9- |
| InChIKey | JWAIBDZPKNYIPW-DHDCSXOGSA-N |
| XLogP | 6.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.37 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|