C16H18N2O4S3 — CID 51825077
4-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(3S,4S)-4-hydroxythiolan-3-yl]butanamide (PubChem CID 51825077) has the molecular formula C16H18N2O4S3 and a molecular weight of 398.53 g/mol. Its IUPAC name is 4-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(3S,4S)-4-hydroxythiolan-3-yl]butanamide.
| Compound Name | 4-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(3S,4S)-4-hydroxythiolan-3-yl]butanamide |
|---|---|
| PubChem CID | 51825077 |
| Molecular Formula | C16H18N2O4S3 |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 4-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[(3S,4S)-4-hydroxythiolan-3-yl]butanamide |
| SMILES | O=C(CCCN1C(=O)/C(=C/c2ccco2)SC1=S)N[C@@H]1CSC[C@H]1O |
| InChI | InChI=1S/C16H18N2O4S3/c19-12-9-24-8-11(12)17-14(20)4-1-5-18-15(21)13(25-16(18)23)7-10-3-2-6-22-10/h2-3,6-7,11-12,19H,1,4-5,8-9H2,(H,17,20)/b13-7-/t11-,12-/m1/s1 |
| InChIKey | GGHUQXUPSZNOTA-YZDJHDEESA-N |
| XLogP | 1.85 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|