C19H13N3O6S — CID 3933545
5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione (PubChem CID 3933545) has the molecular formula C19H13N3O6S and a molecular weight of 411.40 g/mol. Its IUPAC name is 5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3933545 |
| Molecular Formula | C19H13N3O6S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCN1C(=O)SC(=Cc2ccc(Oc3ccc([N+](=O)[O-])cn3)c(OC)c2)C1=O |
| InChI | InChI=1S/C19H13N3O6S/c1-3-8-21-18(23)16(29-19(21)24)10-12-4-6-14(15(9-12)27-2)28-17-7-5-13(11-20-17)22(25)26/h1,4-7,9-11H,8H2,2H3 |
| InChIKey | XNWVRDVKAFDEEO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|