C24H19FN4O5S — CID 126246667
(5E)-3-ethyl-2-(4-fluorophenyl)imino-5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 126246667) has the molecular formula C24H19FN4O5S and a molecular weight of 494.50 g/mol. Its IUPAC name is (5E)-3-ethyl-2-(4-fluorophenyl)imino-5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-ethyl-2-(4-fluorophenyl)imino-5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126246667 |
| Molecular Formula | C24H19FN4O5S |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | (5E)-3-ethyl-2-(4-fluorophenyl)imino-5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc(Oc3ccc([N+](=O)[O-])cn3)c(OC)c2)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C24H19FN4O5S/c1-3-28-23(30)21(35-24(28)27-17-7-5-16(25)6-8-17)13-15-4-10-19(20(12-15)33-2)34-22-11-9-18(14-26-22)29(31)32/h4-14H,3H2,1-2H3/b21-13+,27-24- |
| InChIKey | PZQOOCVQYWXWGM-CIFGJUBISA-N |
| XLogP | 5.55 |
| TPSA | 107.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|