C25H20N4O7S — CID 126156677
2-[(5Z)-5-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide (PubChem CID 126156677) has the molecular formula C25H20N4O7S and a molecular weight of 520.52 g/mol. Its IUPAC name is 2-[(5Z)-5-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126156677 |
| Molecular Formula | C25H20N4O7S |
| Molecular Weight | 520.52 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 2-[(5Z)-5-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(C)cc3)C2=O)ccc1Oc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H20N4O7S/c1-15-5-8-17(9-6-15)27-22(30)14-28-24(31)21(37-25(28)32)13-16-7-10-19(20(12-16)35-2)36-23-18(29(33)34)4-3-11-26-23/h3-13H,14H2,1-2H3,(H,27,30)/b21-13- |
| InChIKey | BQHLISBWTUZZSJ-BKUYFWCQSA-N |
| XLogP | 4.77 |
| TPSA | 140.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|