C23H15Cl3FN3O4S — CID 126175449
(5E)-5-[[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]methylidene]-3-[(3,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126175449) has the molecular formula C23H15Cl3FN3O4S and a molecular weight of 554.81 g/mol. Its IUPAC name is (5E)-5-[[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]methylidene]-3-[(3,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]methylidene]-3-[(3,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126175449 |
| Molecular Formula | C23H15Cl3FN3O4S |
| Molecular Weight | 554.81 g/mol |
| Exact Mass | 552.98 |
| IUPAC Name | (5E)-5-[[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]methylidene]-3-[(3,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(Cc3ccc(Cl)c(Cl)c3)C2=O)ccc1Oc1nc(Cl)ncc1F |
| InChI | InChI=1S/C23H15Cl3FN3O4S/c1-2-33-18-8-12(4-6-17(18)34-20-16(27)10-28-22(26)29-20)9-19-21(31)30(23(32)35-19)11-13-3-5-14(24)15(25)7-13/h3-10H,2,11H2,1H3/b19-9+ |
| InChIKey | PKXXJUDHMZVYIR-DJKKODMXSA-N |
| XLogP | 7.00 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.81 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|